C17H18F4N2O2 — CID 133370583
N-[1-(3,4-diethoxyphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133370583) has the molecular formula C17H18F4N2O2 and a molecular weight of 358.34 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133370583 |
| Molecular Formula | C17H18F4N2O2 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | CCOc1ccc(C(C)Nc2c(F)c(F)nc(F)c2F)cc1OCC |
| InChI | InChI=1S/C17H18F4N2O2/c1-4-24-11-7-6-10(8-12(11)25-5-2)9(3)22-15-13(18)16(20)23-17(21)14(15)19/h6-9H,4-5H2,1-3H3,(H,22,23) |
| InChIKey | YTRAMYIPQQCCAN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|