C14H22N4O2S — CID 56755534
N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide (PubChem CID 56755534) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide.
| Compound Name | N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 56755534 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide |
| SMILES | CN(C(=O)CCC(=O)Nc1nncs1)C1CCCCCC1 |
| InChI | InChI=1S/C14H22N4O2S/c1-18(11-6-4-2-3-5-7-11)13(20)9-8-12(19)16-14-17-15-10-21-14/h10-11H,2-9H2,1H3,(H,16,17,19) |
| InChIKey | MEMNCKGDJPZEKL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |