About N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide
N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide (PubChem CID 56755534) has the molecular formula C14H22N4O2S
and a molecular weight of 310.42 g/mol. Its IUPAC name is N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide.
Molecular Properties
| Compound Name | N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide |
| PubChem CID | 56755534 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide |
| SMILES | CN(C(=O)CCC(=O)Nc1nncs1)C1CCCCCC1 |
| InChI | InChI=1S/C14H22N4O2S/c1-18(11-6-4-2-3-5-7-11)13(20)9-8-12(19)16-14-17-15-10-21-14/h10-11H,2-9H2,1H3,(H,16,17,19) |
| InChIKey | MEMNCKGDJPZEKL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide?
The IUPAC name of N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide (CID 56755534) is N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide.
What is the SMILES notation for N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide?
The canonical SMILES for N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide is CN(C(=O)CCC(=O)Nc1nncs1)C1CCCCCC1.
What is the InChIKey of N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide?
The InChIKey is MEMNCKGDJPZEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2S/c1-18(11-6-4-2-3-5-7-11)13(20)9-8-12(19)16-14-17-15-10-21-14/h10-11H,2-9H2,1H3,(H,16,17,19).
What are the key properties of N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide?
N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide has a molecular weight of 310.42 g/mol, XLogP of 2.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cycloheptyl-N'-methyl-N-(1,3,4-thiadiazol-2-yl)butanediamide is sourced from PubChem (CID 56755534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).