C18H22N4O3 — CID 56758615
2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-[2-(7-methyl-1H-indol-3-yl)ethyl]acetamide (PubChem CID 56758615) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-[2-(7-methyl-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-[2-(7-methyl-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 56758615 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)-N-[2-(7-methyl-1H-indol-3-yl)ethyl]acetamide |
| SMILES | Cc1cccc2c(CCNC(=O)CN3C(=O)NC(=O)C3(C)C)c[nH]c12 |
| InChI | InChI=1S/C18H22N4O3/c1-11-5-4-6-13-12(9-20-15(11)13)7-8-19-14(23)10-22-17(25)21-16(24)18(22,2)3/h4-6,9,20H,7-8,10H2,1-3H3,(H,19,23)(H,21,24,25) |
| InChIKey | PICNVEDOCSJQEN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|