C18H17ClN4O2S — CID 56761930
(2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide (PubChem CID 56761930) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is (2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide.
| Compound Name | (2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide |
|---|---|
| PubChem CID | 56761930 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(4-oxo-1,2,3-benzotriazin-3-yl)propanamide |
| SMILES | C[C@@H](C(=O)NCCSc1ccc(Cl)cc1)n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C18H17ClN4O2S/c1-12(23-18(25)15-4-2-3-5-16(15)21-22-23)17(24)20-10-11-26-14-8-6-13(19)7-9-14/h2-9,12H,10-11H2,1H3,(H,20,24)/t12-/m0/s1 |
| InChIKey | WEFHGBABNAGWDG-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|