C10H16N4O2 — CID 56770223
6-(4-aminopiperidin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 56770223) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-(4-aminopiperidin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(4-aminopiperidin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56770223 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 6-(4-aminopiperidin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(N2CCC(N)CC2)[nH]c1=O |
| InChI | InChI=1S/C10H16N4O2/c1-13-9(15)6-8(12-10(13)16)14-4-2-7(11)3-5-14/h6-7H,2-5,11H2,1H3,(H,12,16) |
| InChIKey | CWUYXYZIJQKRCF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |