C11H16N4O3 — CID 56782763
2-(5,6-dimethylpyridazin-3-yl)oxy-N-(ethylcarbamoyl)acetamide (PubChem CID 56782763) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-(5,6-dimethylpyridazin-3-yl)oxy-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-(5,6-dimethylpyridazin-3-yl)oxy-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 56782763 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(5,6-dimethylpyridazin-3-yl)oxy-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)COc1cc(C)c(C)nn1 |
| InChI | InChI=1S/C11H16N4O3/c1-4-12-11(17)13-9(16)6-18-10-5-7(2)8(3)14-15-10/h5H,4,6H2,1-3H3,(H2,12,13,16,17) |
| InChIKey | UJUVQSSAPKJPDM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |