C16H21NO4S — CID 56792262
N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-1-(3-methylphenyl)methanesulfonamide (PubChem CID 56792262) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-1-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-1-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 56792262 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-1-(3-methylphenyl)methanesulfonamide |
| SMILES | COCCN(Cc1ccco1)S(=O)(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C16H21NO4S/c1-14-5-3-6-15(11-14)13-22(18,19)17(8-10-20-2)12-16-7-4-9-21-16/h3-7,9,11H,8,10,12-13H2,1-2H3 |
| InChIKey | BXFLWOKGMDFSDB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |