C22H20N2O3 — CID 56799706
(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) isoquinoline-1-carboxylate (PubChem CID 56799706) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) isoquinoline-1-carboxylate.
| Compound Name | (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 56799706 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) isoquinoline-1-carboxylate |
| SMILES | O=C(OC(C(=O)N1CCCC1)c1ccccc1)c1nccc2ccccc12 |
| InChI | InChI=1S/C22H20N2O3/c25-21(24-14-6-7-15-24)20(17-9-2-1-3-10-17)27-22(26)19-18-11-5-4-8-16(18)12-13-23-19/h1-5,8-13,20H,6-7,14-15H2 |
| InChIKey | AQPVMKNSCCYECG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |