C22H21N3O4 — CID 42883995
(2-oxo-1-phenyl-2-piperidin-1-ylethyl) 4-oxo-3H-phthalazine-1-carboxylate (PubChem CID 42883995) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 4-oxo-3H-phthalazine-1-carboxylate.
| Compound Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 4-oxo-3H-phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 42883995 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 4-oxo-3H-phthalazine-1-carboxylate |
| SMILES | O=C(OC(C(=O)N1CCCCC1)c1ccccc1)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H21N3O4/c26-20-17-12-6-5-11-16(17)18(23-24-20)22(28)29-19(15-9-3-1-4-10-15)21(27)25-13-7-2-8-14-25/h1,3-6,9-12,19H,2,7-8,13-14H2,(H,24,26) |
| InChIKey | BNJPPUXVRJUGKG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |