C16H27NO3 — CID 56801030
(5-methyl-2-propan-2-ylcyclohexyl) 2-(cyclopropanecarbonylamino)acetate (PubChem CID 56801030) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(cyclopropanecarbonylamino)acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(cyclopropanecarbonylamino)acetate |
|---|---|
| PubChem CID | 56801030 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(cyclopropanecarbonylamino)acetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CNC(=O)C2CC2)C1 |
| InChI | InChI=1S/C16H27NO3/c1-10(2)13-7-4-11(3)8-14(13)20-15(18)9-17-16(19)12-5-6-12/h10-14H,4-9H2,1-3H3,(H,17,19) |
| InChIKey | SXYSPAQGFFERFW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |