C13H15FN2O4S — CID 56801308
N-(6-fluoro-4-methoxy-1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)acetamide (PubChem CID 56801308) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(6-fluoro-4-methoxy-1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-(6-fluoro-4-methoxy-1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 56801308 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-(6-fluoro-4-methoxy-1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1nc2c(OC)cc(F)cc2s1 |
| InChI | InChI=1S/C13H15FN2O4S/c1-18-3-4-20-7-11(17)15-13-16-12-9(19-2)5-8(14)6-10(12)21-13/h5-6H,3-4,7H2,1-2H3,(H,15,16,17) |
| InChIKey | VXHBECYMUJEJRG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|