C15H21N3O3S — CID 56803156
2-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]thiophene-3-carbonitrile (PubChem CID 56803156) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]thiophene-3-carbonitrile.
| Compound Name | 2-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 56803156 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]thiophene-3-carbonitrile |
| SMILES | CCOCC(O)CN1CCN(C(=O)c2sccc2C#N)CC1 |
| InChI | InChI=1S/C15H21N3O3S/c1-2-21-11-13(19)10-17-4-6-18(7-5-17)15(20)14-12(9-16)3-8-22-14/h3,8,13,19H,2,4-7,10-11H2,1H3 |
| InChIKey | JTQHBQQCYMJDKG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |