C17H21N3O3S — CID 56806271
3-[2,2-dimethylpropyl(pyridin-3-yl)sulfamoyl]benzamide (PubChem CID 56806271) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-[2,2-dimethylpropyl(pyridin-3-yl)sulfamoyl]benzamide.
| Compound Name | 3-[2,2-dimethylpropyl(pyridin-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 56806271 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-[2,2-dimethylpropyl(pyridin-3-yl)sulfamoyl]benzamide |
| SMILES | CC(C)(C)CN(c1cccnc1)S(=O)(=O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-17(2,3)12-20(14-7-5-9-19-11-14)24(22,23)15-8-4-6-13(10-15)16(18)21/h4-11H,12H2,1-3H3,(H2,18,21) |
| InChIKey | FZLZCNRZKVONTP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |