C22H18FN3O — CID 56809441
3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-pyridin-2-ylpropanamide (PubChem CID 56809441) has the molecular formula C22H18FN3O and a molecular weight of 359.40 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-pyridin-2-ylpropanamide.
| Compound Name | 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 56809441 |
| Molecular Formula | C22H18FN3O |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-pyridin-2-ylpropanamide |
| SMILES | O=C(CCc1c(-c2ccc(F)cc2)[nH]c2ccccc12)Nc1ccccn1 |
| InChI | InChI=1S/C22H18FN3O/c23-16-10-8-15(9-11-16)22-18(17-5-1-2-6-19(17)25-22)12-13-21(27)26-20-7-3-4-14-24-20/h1-11,14,25H,12-13H2,(H,24,26,27) |
| InChIKey | BRXZFUXNZFSNMB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |