C22H19FN4O2 — CID 78818180
N'-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78818180) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is N'-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78818180 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N'-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(CCc1c(-c2ccc(F)cc2)[nH]c2ccccc12)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C22H19FN4O2/c23-15-9-7-14(8-10-15)21-17(16-4-1-2-5-18(16)25-21)11-12-20(28)26-27-22(29)19-6-3-13-24-19/h1-10,13,24-25H,11-12H2,(H,26,28)(H,27,29) |
| InChIKey | CHDZWEDARLRXAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|