C22H18BrFN4O2 — CID 55506995
4-bromo-N'-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 55506995) has the molecular formula C22H18BrFN4O2 and a molecular weight of 469.31 g/mol. Its IUPAC name is 4-bromo-N'-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 55506995 |
| Molecular Formula | C22H18BrFN4O2 |
| Molecular Weight | 469.31 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 4-bromo-N'-[3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(CCc1c(-c2ccccc2)[nH]c2ccc(F)cc12)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C22H18BrFN4O2/c23-14-10-19(25-12-14)22(30)28-27-20(29)9-7-16-17-11-15(24)6-8-18(17)26-21(16)13-4-2-1-3-5-13/h1-6,8,10-12,25-26H,7,9H2,(H,27,29)(H,28,30) |
| InChIKey | VYBGJFPBOGLRAA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|