C26H24FN3O2 — CID 55671297
3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]propanamide (PubChem CID 55671297) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]propanamide.
| Compound Name | 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]propanamide |
|---|---|
| PubChem CID | 55671297 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-[2-[2-(methylamino)-2-oxoethyl]phenyl]propanamide |
| SMILES | CNC(=O)Cc1ccccc1NC(=O)CCc1c(-c2ccc(F)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C26H24FN3O2/c1-28-25(32)16-18-6-2-4-8-22(18)29-24(31)15-14-21-20-7-3-5-9-23(20)30-26(21)17-10-12-19(27)13-11-17/h2-13,30H,14-16H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | KRENUQAXKKOXSL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |