C26H24FN3O3 — CID 60578471
methyl N-[4-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]phenyl]-N-methylcarbamate (PubChem CID 60578471) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is methyl N-[4-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]phenyl]-N-methylcarbamate.
| Compound Name | methyl N-[4-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 60578471 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | methyl N-[4-[3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoylamino]phenyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)c1ccc(NC(=O)CCc2c(-c3ccc(F)cc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H24FN3O3/c1-30(26(32)33-2)20-13-11-19(12-14-20)28-24(31)16-15-22-21-5-3-4-6-23(21)29-25(22)17-7-9-18(27)10-8-17/h3-14,29H,15-16H2,1-2H3,(H,28,31) |
| InChIKey | NFOTXXOCPAAHCB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |