C17H21N3OS — CID 56813193
2-[cyclopentyl-[(2-phenyl-1,3-thiazol-4-yl)methyl]amino]acetamide (PubChem CID 56813193) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-[cyclopentyl-[(2-phenyl-1,3-thiazol-4-yl)methyl]amino]acetamide.
| Compound Name | 2-[cyclopentyl-[(2-phenyl-1,3-thiazol-4-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 56813193 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[cyclopentyl-[(2-phenyl-1,3-thiazol-4-yl)methyl]amino]acetamide |
| SMILES | NC(=O)CN(Cc1csc(-c2ccccc2)n1)C1CCCC1 |
| InChI | InChI=1S/C17H21N3OS/c18-16(21)11-20(15-8-4-5-9-15)10-14-12-22-17(19-14)13-6-2-1-3-7-13/h1-3,6-7,12,15H,4-5,8-11H2,(H2,18,21) |
| InChIKey | UYXZDVLFVCZYTR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |