C17H14N2O4S — CID 56814800
N-(3-cyanophenyl)sulfonyl-2-(2,3-dihydro-1-benzofuran-5-yl)acetamide (PubChem CID 56814800) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-(3-cyanophenyl)sulfonyl-2-(2,3-dihydro-1-benzofuran-5-yl)acetamide.
| Compound Name | N-(3-cyanophenyl)sulfonyl-2-(2,3-dihydro-1-benzofuran-5-yl)acetamide |
|---|---|
| PubChem CID | 56814800 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(3-cyanophenyl)sulfonyl-2-(2,3-dihydro-1-benzofuran-5-yl)acetamide |
| SMILES | N#Cc1cccc(S(=O)(=O)NC(=O)Cc2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C17H14N2O4S/c18-11-13-2-1-3-15(9-13)24(21,22)19-17(20)10-12-4-5-16-14(8-12)6-7-23-16/h1-5,8-9H,6-7,10H2,(H,19,20) |
| InChIKey | RUHSEQNKNFCYNK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |