C16H13NO4S — CID 56822051
4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfonyl]phenol (PubChem CID 56822051) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfonyl]phenol.
| Compound Name | 4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfonyl]phenol |
|---|---|
| PubChem CID | 56822051 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-[(5-phenyl-1,2-oxazol-3-yl)methylsulfonyl]phenol |
| SMILES | O=S(=O)(Cc1cc(-c2ccccc2)on1)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H13NO4S/c18-14-6-8-15(9-7-14)22(19,20)11-13-10-16(21-17-13)12-4-2-1-3-5-12/h1-10,18H,11H2 |
| InChIKey | MOMTUFVRBZHKSO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |