C16H19N3O2S — CID 56823088
1-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(oxolan-2-ylmethyl)urea (PubChem CID 56823088) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 56823088 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-3-(oxolan-2-ylmethyl)urea |
| SMILES | Cc1csc(-c2ccc(NC(=O)NCC3CCCO3)cc2)n1 |
| InChI | InChI=1S/C16H19N3O2S/c1-11-10-22-15(18-11)12-4-6-13(7-5-12)19-16(20)17-9-14-3-2-8-21-14/h4-7,10,14H,2-3,8-9H2,1H3,(H2,17,19,20) |
| InChIKey | IMRLRTUPBZXBCP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |