C18H24ClN3O2 — CID 56824073
6-tert-butyl-2-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]pyridazin-3-one (PubChem CID 56824073) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 6-tert-butyl-2-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 56824073 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 6-tert-butyl-2-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]pyridazin-3-one |
| SMILES | CN(CCOc1ccc(Cl)cc1)Cn1nc(C(C)(C)C)ccc1=O |
| InChI | InChI=1S/C18H24ClN3O2/c1-18(2,3)16-9-10-17(23)22(20-16)13-21(4)11-12-24-15-7-5-14(19)6-8-15/h5-10H,11-13H2,1-4H3 |
| InChIKey | HGFAJNZJIHMWFW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |