C28H33NO7 — CID 56838994
(3S,4S,5S,6R)-6-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3,4-bis(phenylmethoxy)-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 56838994) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is (3S,4S,5S,6R)-6-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3,4-bis(phenylmethoxy)-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (3S,4S,5S,6R)-6-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3,4-bis(phenylmethoxy)-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 56838994 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (3S,4S,5S,6R)-6-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3,4-bis(phenylmethoxy)-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CO[C@@H]1O[C@H]([C@@H]2C(=O)N3C[C@H](OCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]23)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C28H33NO7/c1-28(2)35-24-23(34-27(31-3)25(24)36-28)20-21-22(33-16-18-12-8-5-9-13-18)19(14-29(21)26(20)30)32-15-17-10-6-4-7-11-17/h4-13,19-25,27H,14-16H2,1-3H3/t19-,20+,21-,22+,23+,24-,25-,27+/m0/s1 |
| InChIKey | LYUVFLBEPNREFJ-ZWSXUCFBSA-N |
| XLogP | 2.89 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |