C18H23NO4S — CID 56839486
ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-2-(2-hydroxynaphthalen-1-yl)acetate (PubChem CID 56839486) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-2-(2-hydroxynaphthalen-1-yl)acetate.
| Compound Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-2-(2-hydroxynaphthalen-1-yl)acetate |
|---|---|
| PubChem CID | 56839486 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-2-(2-hydroxynaphthalen-1-yl)acetate |
| SMILES | CCOC(=O)[C@H](N[S@](=O)C(C)(C)C)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C18H23NO4S/c1-5-23-17(21)16(19-24(22)18(2,3)4)15-13-9-7-6-8-12(13)10-11-14(15)20/h6-11,16,19-20H,5H2,1-4H3/t16-,24-/m1/s1 |
| InChIKey | VXMDDNQDXGSDBR-VOIUYBSRSA-N |
| XLogP | 3.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|