C13H12F2O3 — CID 56840412
5,5-difluoro-4-hydroxy-6-[(E)-2-phenylethenyl]oxan-2-one (PubChem CID 56840412) has the molecular formula C13H12F2O3 and a molecular weight of 254.23 g/mol. Its IUPAC name is 5,5-difluoro-4-hydroxy-6-[(E)-2-phenylethenyl]oxan-2-one.
| Compound Name | 5,5-difluoro-4-hydroxy-6-[(E)-2-phenylethenyl]oxan-2-one |
|---|---|
| PubChem CID | 56840412 |
| Molecular Formula | C13H12F2O3 |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5,5-difluoro-4-hydroxy-6-[(E)-2-phenylethenyl]oxan-2-one |
| SMILES | O=C1CC(O)C(F)(F)C(/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C13H12F2O3/c14-13(15)10(16)8-12(17)18-11(13)7-6-9-4-2-1-3-5-9/h1-7,10-11,16H,8H2/b7-6+ |
| InChIKey | OFUTZULBDATPRG-VOTSOKGWSA-N |
| XLogP | 2.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |