C23H30FN3O — CID 56854779
2-[4-[1-[3-(4-fluorophenyl)phenyl]piperidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 56854779) has the molecular formula C23H30FN3O and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-[4-[1-[3-(4-fluorophenyl)phenyl]piperidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[1-[3-(4-fluorophenyl)phenyl]piperidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 56854779 |
| Molecular Formula | C23H30FN3O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 2-[4-[1-[3-(4-fluorophenyl)phenyl]piperidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(C2CCN(c3cccc(-c4ccc(F)cc4)c3)CC2)CC1 |
| InChI | InChI=1S/C23H30FN3O/c24-21-6-4-19(5-7-21)20-2-1-3-23(18-20)26-10-8-22(9-11-26)27-14-12-25(13-15-27)16-17-28/h1-7,18,22,28H,8-17H2 |
| InChIKey | IMFIGUXSCDFKSB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |