C28H32N4O4 — CID 56857600
1-[2-[(4aR,8aR)-6-(3-phenylpropanoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 56857600) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 1-[2-[(4aR,8aR)-6-(3-phenylpropanoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-[(4aR,8aR)-6-(3-phenylpropanoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 56857600 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 1-[2-[(4aR,8aR)-6-(3-phenylpropanoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccccc2C(=O)N2CCC[C@@H]3CN(C(=O)CCc4ccccc4)CC[C@H]32)C(=O)N1 |
| InChI | InChI=1S/C28H32N4O4/c33-25-15-18-32(28(36)29-25)24-11-5-4-10-22(24)27(35)31-16-6-9-21-19-30(17-14-23(21)31)26(34)13-12-20-7-2-1-3-8-20/h1-5,7-8,10-11,21,23H,6,9,12-19H2,(H,29,33,36)/t21-,23-/m1/s1 |
| InChIKey | GETMTUOSVXXZFD-FYYLOGMGSA-N |
| XLogP | 3.22 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |