C24H27N5O4 — CID 56860383
3-[2-(1,3-benzodioxol-5-ylmethyl)-5-oxopyrrolidin-2-yl]-N-[3-(benzotriazol-1-yl)propyl]propanamide (PubChem CID 56860383) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-ylmethyl)-5-oxopyrrolidin-2-yl]-N-[3-(benzotriazol-1-yl)propyl]propanamide.
| Compound Name | 3-[2-(1,3-benzodioxol-5-ylmethyl)-5-oxopyrrolidin-2-yl]-N-[3-(benzotriazol-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 56860383 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-ylmethyl)-5-oxopyrrolidin-2-yl]-N-[3-(benzotriazol-1-yl)propyl]propanamide |
| SMILES | O=C(CCC1(Cc2ccc3c(c2)OCO3)CCC(=O)N1)NCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C24H27N5O4/c30-22(25-12-3-13-29-19-5-2-1-4-18(19)27-28-29)8-10-24(11-9-23(31)26-24)15-17-6-7-20-21(14-17)33-16-32-20/h1-2,4-7,14H,3,8-13,15-16H2,(H,25,30)(H,26,31) |
| InChIKey | IHDGPSWEPVYLQX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|