C16H17N5S — CID 56864056
2-amino-6-(2-amino-4-methyl-1,3-thiazol-5-yl)-4-cyclohex-3-en-1-ylpyridine-3-carbonitrile (PubChem CID 56864056) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-amino-6-(2-amino-4-methyl-1,3-thiazol-5-yl)-4-cyclohex-3-en-1-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(2-amino-4-methyl-1,3-thiazol-5-yl)-4-cyclohex-3-en-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56864056 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-amino-6-(2-amino-4-methyl-1,3-thiazol-5-yl)-4-cyclohex-3-en-1-ylpyridine-3-carbonitrile |
| SMILES | Cc1nc(N)sc1-c1cc(C2CC=CCC2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C16H17N5S/c1-9-14(22-16(19)20-9)13-7-11(10-5-3-2-4-6-10)12(8-17)15(18)21-13/h2-3,7,10H,4-6H2,1H3,(H2,18,21)(H2,19,20) |
| InChIKey | FAQDQQIFRRSPGL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|