C16H16N4 — CID 95552721
2-amino-4-[(1S)-cyclohex-3-en-1-yl]-6-(1H-pyrrol-2-yl)pyridine-3-carbonitrile (PubChem CID 95552721) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-amino-4-[(1S)-cyclohex-3-en-1-yl]-6-(1H-pyrrol-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[(1S)-cyclohex-3-en-1-yl]-6-(1H-pyrrol-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 95552721 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-amino-4-[(1S)-cyclohex-3-en-1-yl]-6-(1H-pyrrol-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c([C@@H]2CC=CCC2)cc(-c2ccc[nH]2)nc1N |
| InChI | InChI=1S/C16H16N4/c17-10-13-12(11-5-2-1-3-6-11)9-15(20-16(13)18)14-7-4-8-19-14/h1-2,4,7-9,11,19H,3,5-6H2,(H2,18,20)/t11-/m1/s1 |
| InChIKey | NOYGUCLNVNNEEJ-LLVKDONJSA-N |
| XLogP | 3.35 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|