C16H23N3O3 — CID 56866125
[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)methanone (PubChem CID 56866125) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)methanone.
| Compound Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 56866125 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)methanone |
| SMILES | Cc1[nH]nc(C2CC2)c1C(=O)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C16H23N3O3/c1-8-14(15(18-17-8)9-2-3-9)16(22)19-6-10-4-12(20)13(21)5-11(10)7-19/h9-13,20-21H,2-7H2,1H3,(H,17,18)/t10-,11+,12-,13-/m0/s1 |
| InChIKey | MNGBYCFVUSFQMI-RNJOBUHISA-N |
| XLogP | 0.80 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |