C12H17ClN4O3 — CID 77085722
[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-4-chloro-1H-pyrazol-5-yl)methanone (PubChem CID 77085722) has the molecular formula C12H17ClN4O3 and a molecular weight of 300.75 g/mol. Its IUPAC name is [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-4-chloro-1H-pyrazol-5-yl)methanone.
| Compound Name | [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-4-chloro-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 77085722 |
| Molecular Formula | C12H17ClN4O3 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-amino-4-chloro-1H-pyrazol-5-yl)methanone |
| SMILES | Nc1n[nH]c(C(=O)N2C[C@H]3C[C@H](O)[C@H](O)C[C@H]3C2)c1Cl |
| InChI | InChI=1S/C12H17ClN4O3/c13-9-10(15-16-11(9)14)12(20)17-3-5-1-7(18)8(19)2-6(5)4-17/h5-8,18-19H,1-4H2,(H3,14,15,16)/t5-,6+,7+,8- |
| InChIKey | QSGKYBGSLVSHJL-SOSBWXJGSA-N |
| XLogP | -0.15 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |