C16H14ClNO2 — CID 56866256
4-chloro-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid (PubChem CID 56866256) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 4-chloro-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid.
| Compound Name | 4-chloro-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 56866256 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-chloro-3-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(-c2cccc3c2CCNC3)c1 |
| InChI | InChI=1S/C16H14ClNO2/c17-15-5-4-10(16(19)20)8-14(15)13-3-1-2-11-9-18-7-6-12(11)13/h1-5,8,18H,6-7,9H2,(H,19,20) |
| InChIKey | ACLPNOZHVRLZPZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |