C19H25N5O — CID 56866828
4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]-N-(3-imidazol-1-ylpropyl)pyridine-2-carboxamide (PubChem CID 56866828) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]-N-(3-imidazol-1-ylpropyl)pyridine-2-carboxamide.
| Compound Name | 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]-N-(3-imidazol-1-ylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56866828 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]-N-(3-imidazol-1-ylpropyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cc(N[C@@H]2C[C@H]3CC[C@@H]2C3)ccn1 |
| InChI | InChI=1S/C19H25N5O/c25-19(22-5-1-8-24-9-7-20-13-24)18-12-16(4-6-21-18)23-17-11-14-2-3-15(17)10-14/h4,6-7,9,12-15,17H,1-3,5,8,10-11H2,(H,21,23)(H,22,25)/t14-,15+,17+/m0/s1 |
| InChIKey | FQJAGQZSJSWKTD-ZMSDIMECSA-N |
| XLogP | 2.70 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|