C19H27N7O2 — CID 170510742
N-[[(2S,5R)-5-[2-(3-imidazol-1-ylpropylamino)-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]pyrazine-2-carboxamide (PubChem CID 170510742) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[[(2S,5R)-5-[2-(3-imidazol-1-ylpropylamino)-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[(2S,5R)-5-[2-(3-imidazol-1-ylpropylamino)-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 170510742 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[[(2S,5R)-5-[2-(3-imidazol-1-ylpropylamino)-2-oxoethyl]-1-methylpyrrolidin-2-yl]methyl]pyrazine-2-carboxamide |
| SMILES | CN1[C@@H](CC(=O)NCCCn2ccnc2)CC[C@H]1CNC(=O)c1cnccn1 |
| InChI | InChI=1S/C19H27N7O2/c1-25-15(11-18(27)23-5-2-9-26-10-8-21-14-26)3-4-16(25)12-24-19(28)17-13-20-6-7-22-17/h6-8,10,13-16H,2-5,9,11-12H2,1H3,(H,23,27)(H,24,28)/t15-,16+/m1/s1 |
| InChIKey | YESGKLLXYYHDNI-CVEARBPZSA-N |
| XLogP | 0.46 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|