About ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate
ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate (PubChem CID 56870453) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate.
Molecular Properties
| Compound Name | ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate |
| PubChem CID | 56870453 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate |
| SMILES | CCOC(=O)CC(C)Nc1nccc(-c2ccc(C)nc2C)n1 |
| InChI | InChI=1S/C17H22N4O2/c1-5-23-16(22)10-12(3)20-17-18-9-8-15(21-17)14-7-6-11(2)19-13(14)4/h6-9,12H,5,10H2,1-4H3,(H,18,20,21) |
| InChIKey | CXGQFRPOKUCNRU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate?
The IUPAC name of ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate (CID 56870453) is ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate.
What is the SMILES notation for ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate?
The canonical SMILES for ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate is CCOC(=O)CC(C)Nc1nccc(-c2ccc(C)nc2C)n1.
What is the InChIKey of ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate?
The InChIKey is CXGQFRPOKUCNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-5-23-16(22)10-12(3)20-17-18-9-8-15(21-17)14-7-6-11(2)19-13(14)4/h6-9,12H,5,10H2,1-4H3,(H,18,20,21).
What are the key properties of ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate?
ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate has a molecular weight of 314.39 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[4-(2,6-dimethyl-3-pyridinyl)pyrimidin-2-yl]amino]butanoate is sourced from PubChem (CID 56870453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).