C19H24N2O2 — CID 56874518
3-[(1S,2S,6R,7R)-4-azatricyclo[5.2.1.02,6]decane-4-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one (PubChem CID 56874518) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-[(1S,2S,6R,7R)-4-azatricyclo[5.2.1.02,6]decane-4-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 3-[(1S,2S,6R,7R)-4-azatricyclo[5.2.1.02,6]decane-4-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 56874518 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-[(1S,2S,6R,7R)-4-azatricyclo[5.2.1.02,6]decane-4-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one |
| SMILES | Cc1[nH]c2c(c1C(=O)N1C[C@@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C1)C(=O)CCC2 |
| InChI | InChI=1S/C19H24N2O2/c1-10-17(18-15(20-10)3-2-4-16(18)22)19(23)21-8-13-11-5-6-12(7-11)14(13)9-21/h11-14,20H,2-9H2,1H3/t11-,12+,13-,14+ |
| InChIKey | HUWYXYRPORCQRR-KPWCQOOUSA-N |
| XLogP | 2.96 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |