C19H24N2O2 — CID 133138568
3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one (PubChem CID 133138568) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 133138568 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl]-2-methyl-1,5,6,7-tetrahydroindol-4-one |
| SMILES | CC1=CC[C@H]2CN(C(=O)c3c(C)[nH]c4c3C(=O)CCC4)C[C@H]2C1 |
| InChI | InChI=1S/C19H24N2O2/c1-11-6-7-13-9-21(10-14(13)8-11)19(23)17-12(2)20-15-4-3-5-16(22)18(15)17/h6,13-14,20H,3-5,7-10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | HRXOCLNYWBPWAI-UONOGXRCSA-N |
| XLogP | 3.27 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|