C21H26N6 — CID 56879607
(1R,9S)-5-amino-12-cyclopentyl-3-(1-ethylpyrazol-4-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile (PubChem CID 56879607) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is (1R,9S)-5-amino-12-cyclopentyl-3-(1-ethylpyrazol-4-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile.
| Compound Name | (1R,9S)-5-amino-12-cyclopentyl-3-(1-ethylpyrazol-4-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile |
|---|---|
| PubChem CID | 56879607 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (1R,9S)-5-amino-12-cyclopentyl-3-(1-ethylpyrazol-4-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile |
| SMILES | CCn1cc(-c2c(C#N)c(N)nc3c2[C@H]2CC[C@@H](C3)N2C2CCCC2)cn1 |
| InChI | InChI=1S/C21H26N6/c1-2-26-12-13(11-24-26)19-16(10-22)21(23)25-17-9-15-7-8-18(20(17)19)27(15)14-5-3-4-6-14/h11-12,14-15,18H,2-9H2,1H3,(H2,23,25)/t15-,18+/m0/s1 |
| InChIKey | VRYFOMPJEWVKMW-MAUKXSAKSA-N |
| XLogP | 3.42 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |