C20H23N5O2S — CID 171709760
(1R,9S)-5-amino-12-cyclopentyl-3-(1,3-thiazol-5-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile;formic acid (PubChem CID 171709760) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is (1R,9S)-5-amino-12-cyclopentyl-3-(1,3-thiazol-5-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile;formic acid.
| Compound Name | (1R,9S)-5-amino-12-cyclopentyl-3-(1,3-thiazol-5-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile;formic acid |
|---|---|
| PubChem CID | 171709760 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (1R,9S)-5-amino-12-cyclopentyl-3-(1,3-thiazol-5-yl)-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile;formic acid |
| SMILES | N#Cc1c(N)nc2c(c1-c1cncs1)[C@H]1CC[C@@H](C2)N1C1CCCC1.O=CO |
| InChI | InChI=1S/C19H21N5S.CH2O2/c20-8-13-17(16-9-22-10-25-16)18-14(23-19(13)21)7-12-5-6-15(18)24(12)11-3-1-2-4-11;2-1-3/h9-12,15H,1-7H2,(H2,21,23);1H,(H,2,3)/t12-,15+;/m0./s1 |
| InChIKey | VFLAIIQWABXWSW-SBKWZQTDSA-N |
| XLogP | 3.36 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|