C20H29N5O — CID 56885475
N,N,5-trimethyl-2-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrimidin-4-amine (PubChem CID 56885475) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is N,N,5-trimethyl-2-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrimidin-4-amine.
| Compound Name | N,N,5-trimethyl-2-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56885475 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | N,N,5-trimethyl-2-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrimidin-4-amine |
| SMILES | C=CCCC(CN(C)Cc1cccnc1)Oc1ncc(C)c(N(C)C)n1 |
| InChI | InChI=1S/C20H29N5O/c1-6-7-10-18(15-25(5)14-17-9-8-11-21-13-17)26-20-22-12-16(2)19(23-20)24(3)4/h6,8-9,11-13,18H,1,7,10,14-15H2,2-5H3 |
| InChIKey | DFSUACIMHCNJSP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|