C19H27N5O — CID 56899834
N,N-dimethyl-6-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrazin-2-amine (PubChem CID 56899834) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is N,N-dimethyl-6-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrazin-2-amine.
| Compound Name | N,N-dimethyl-6-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrazin-2-amine |
|---|---|
| PubChem CID | 56899834 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N,N-dimethyl-6-[1-[methyl(pyridin-3-ylmethyl)amino]hex-5-en-2-yloxy]pyrazin-2-amine |
| SMILES | C=CCCC(CN(C)Cc1cccnc1)Oc1cncc(N(C)C)n1 |
| InChI | InChI=1S/C19H27N5O/c1-5-6-9-17(15-24(4)14-16-8-7-10-20-11-16)25-19-13-21-12-18(22-19)23(2)3/h5,7-8,10-13,17H,1,6,9,14-15H2,2-4H3 |
| InChIKey | YBXMJEDXAIEGEN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|