C16H23FN2O — CID 56907793
1-(4-fluorophenyl)-4-(oxolan-3-ylmethyl)-1,4-diazepane (PubChem CID 56907793) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(oxolan-3-ylmethyl)-1,4-diazepane.
| Compound Name | 1-(4-fluorophenyl)-4-(oxolan-3-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 56907793 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(oxolan-3-ylmethyl)-1,4-diazepane |
| SMILES | Fc1ccc(N2CCCN(CC3CCOC3)CC2)cc1 |
| InChI | InChI=1S/C16H23FN2O/c17-15-2-4-16(5-3-15)19-8-1-7-18(9-10-19)12-14-6-11-20-13-14/h2-5,14H,1,6-13H2 |
| InChIKey | PESXFBRAFQHGRW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |