C21H25N5O — CID 56917221
6-[4-[(1-ethylindol-6-yl)methyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 56917221) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 6-[4-[(1-ethylindol-6-yl)methyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 6-[4-[(1-ethylindol-6-yl)methyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56917221 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 6-[4-[(1-ethylindol-6-yl)methyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CCn1ccc2ccc(CN3CCN(c4ccc(C(N)=O)cn4)CC3)cc21 |
| InChI | InChI=1S/C21H25N5O/c1-2-25-8-7-17-4-3-16(13-19(17)25)15-24-9-11-26(12-10-24)20-6-5-18(14-23-20)21(22)27/h3-8,13-14H,2,9-12,15H2,1H3,(H2,22,27) |
| InChIKey | MGIKIKZFJLFJOO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |