C15H21BrO7 — CID 56925313
methyl (2Z)-2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]-2-bromoacetate (PubChem CID 56925313) has the molecular formula C15H21BrO7 and a molecular weight of 393.23 g/mol. Its IUPAC name is methyl (2Z)-2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]-2-bromoacetate.
| Compound Name | methyl (2Z)-2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]-2-bromoacetate |
|---|---|
| PubChem CID | 56925313 |
| Molecular Formula | C15H21BrO7 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | methyl (2Z)-2-[(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]-2-bromoacetate |
| SMILES | COC(=O)/C(Br)=C1/O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H21BrO7/c1-14(2)19-6-7(21-14)9-11-12(23-15(3,4)22-11)10(20-9)8(16)13(17)18-5/h7,9,11-12H,6H2,1-5H3/b10-8-/t7-,9-,11+,12-/m1/s1 |
| InChIKey | YSDZZLKOMOWVFE-XNAXMDTJSA-N |
| XLogP | 1.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|