C21H25NO9 — CID 56925420
methyl (2Z)-2-(3-nitrophenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate (PubChem CID 56925420) has the molecular formula C21H25NO9 and a molecular weight of 435.43 g/mol. Its IUPAC name is methyl (2Z)-2-(3-nitrophenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate.
| Compound Name | methyl (2Z)-2-(3-nitrophenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate |
|---|---|
| PubChem CID | 56925420 |
| Molecular Formula | C21H25NO9 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | methyl (2Z)-2-(3-nitrophenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate |
| SMILES | COC(=O)/C(=C1\O[C@@H]2COC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@H]12)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25NO9/c1-20(2)27-10-13-15(29-20)17-18(31-21(3,4)30-17)16(28-13)14(19(23)26-5)11-7-6-8-12(9-11)22(24)25/h6-9,13,15,17-18H,10H2,1-5H3/b16-14-/t13-,15-,17+,18-/m1/s1 |
| InChIKey | DROLDPHZMSIDDZ-NRESZDDGSA-N |
| XLogP | 2.55 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|