C26H29NO8 — CID 102482726
(3aR,4Z,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)-(3-nitrophenyl)methylidene]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole (PubChem CID 102482726) has the molecular formula C26H29NO8 and a molecular weight of 483.52 g/mol. Its IUPAC name is (3aR,4Z,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)-(3-nitrophenyl)methylidene]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4Z,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)-(3-nitrophenyl)methylidene]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 102482726 |
| Molecular Formula | C26H29NO8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (3aR,4Z,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)-(3-nitrophenyl)methylidene]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
| SMILES | COc1ccc(/C(=C2/O[C@@H]([C@H]3COC(C)(C)O3)[C@H]3OC(C)(C)O[C@@H]23)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H29NO8/c1-25(2)31-14-19(33-25)21-23-24(35-26(3,4)34-23)22(32-21)20(15-9-11-18(30-5)12-10-15)16-7-6-8-17(13-16)27(28)29/h6-13,19,21,23-24H,14H2,1-5H3/b22-20-/t19-,21+,23-,24+/m1/s1 |
| InChIKey | MCNFEKSNYPUUIV-DLPPJFMRSA-N |
| XLogP | 4.43 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|