C16H17NO2 — CID 56926335
1-(2,5-dimethylpyrrol-1-yl)-4-phenylbutane-1,4-dione (PubChem CID 56926335) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrrol-1-yl)-4-phenylbutane-1,4-dione.
| Compound Name | 1-(2,5-dimethylpyrrol-1-yl)-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 56926335 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-(2,5-dimethylpyrrol-1-yl)-4-phenylbutane-1,4-dione |
| SMILES | Cc1ccc(C)n1C(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-12-8-9-13(2)17(12)16(19)11-10-15(18)14-6-4-3-5-7-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | DZQUONDFNTWPBW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |