C18H19NO3 — CID 56927140
(1S,3R,6S,7R,8S,9S)-3-methoxy-5,8-dimethyl-9-phenyl-4-azatricyclo[4.3.1.03,7]dec-4-ene-2,10-dione (PubChem CID 56927140) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (1S,3R,6S,7R,8S,9S)-3-methoxy-5,8-dimethyl-9-phenyl-4-azatricyclo[4.3.1.03,7]dec-4-ene-2,10-dione.
| Compound Name | (1S,3R,6S,7R,8S,9S)-3-methoxy-5,8-dimethyl-9-phenyl-4-azatricyclo[4.3.1.03,7]dec-4-ene-2,10-dione |
|---|---|
| PubChem CID | 56927140 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1S,3R,6S,7R,8S,9S)-3-methoxy-5,8-dimethyl-9-phenyl-4-azatricyclo[4.3.1.03,7]dec-4-ene-2,10-dione |
| SMILES | CO[C@@]12N=C(C)[C@H]3C(=O)[C@@H](C1=O)[C@@H](c1ccccc1)[C@H](C)[C@H]32 |
| InChI | InChI=1S/C18H19NO3/c1-9-12(11-7-5-4-6-8-11)14-16(20)13-10(2)19-18(22-3,15(9)13)17(14)21/h4-9,12-15H,1-3H3/t9-,12+,13+,14-,15+,18+/m0/s1 |
| InChIKey | YMCZYRUBXNUNST-RWNMRBQOSA-N |
| XLogP | 2.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|